About 2-phenyl-2,7-dihydro-as-indacene
2-phenyl-2,7-dihydro-as-indacene (PubChem CID 168781152) has the molecular formula C18H14
and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-phenyl-2,7-dihydro-as-indacene.
Molecular Properties
| Compound Name | 2-phenyl-2,7-dihydro-as-indacene |
| PubChem CID | 168781152 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-phenyl-2,7-dihydro-as-indacene |
| SMILES | C1=c2ccc3c(c2=CC1)=CC(c1ccccc1)C=3 |
| InChI | InChI=1S/C18H14/c1-2-5-13(6-3-1)16-11-15-10-9-14-7-4-8-17(14)18(15)12-16/h1-3,5-12,16H,4H2 |
| InChIKey | YZTGGYHOHNPTLF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-phenyl-2,7-dihydro-as-indacene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2,7-dihydro-as-indacene?
The IUPAC name of 2-phenyl-2,7-dihydro-as-indacene (CID 168781152) is 2-phenyl-2,7-dihydro-as-indacene.
What is the SMILES notation for 2-phenyl-2,7-dihydro-as-indacene?
The canonical SMILES for 2-phenyl-2,7-dihydro-as-indacene is C1=c2ccc3c(c2=CC1)=CC(c1ccccc1)C=3.
What is the InChIKey of 2-phenyl-2,7-dihydro-as-indacene?
The InChIKey is YZTGGYHOHNPTLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14/c1-2-5-13(6-3-1)16-11-15-10-9-14-7-4-8-17(14)18(15)12-16/h1-3,5-12,16H,4H2.
What are the key properties of 2-phenyl-2,7-dihydro-as-indacene?
2-phenyl-2,7-dihydro-as-indacene has a molecular weight of 230.31 g/mol, XLogP of 1.01, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2,7-dihydro-as-indacene is sourced from PubChem (CID 168781152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).