C17H20F2 — CID 23205703
3-butyl-3-(difluoromethyl)-6-phenylcyclohexa-1,4-diene (PubChem CID 23205703) has the molecular formula C17H20F2 and a molecular weight of 262.34 g/mol. Its IUPAC name is 3-butyl-3-(difluoromethyl)-6-phenylcyclohexa-1,4-diene.
| Compound Name | 3-butyl-3-(difluoromethyl)-6-phenylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 23205703 |
| Molecular Formula | C17H20F2 |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3-butyl-3-(difluoromethyl)-6-phenylcyclohexa-1,4-diene |
| SMILES | CCCCC1(C(F)F)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C17H20F2/c1-2-3-11-17(16(18)19)12-9-15(10-13-17)14-7-5-4-6-8-14/h4-10,12-13,15-16H,2-3,11H2,1H3 |
| InChIKey | XPFUMVIROGDQCS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|