C22H21F3O — CID 67763524
1-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)-4-(trifluoromethoxy)benzene (PubChem CID 67763524) has the molecular formula C22H21F3O and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)-4-(trifluoromethoxy)benzene.
| Compound Name | 1-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 67763524 |
| Molecular Formula | C22H21F3O |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-(4-phenyl-1-propylcyclohexa-2,5-dien-1-yl)-4-(trifluoromethoxy)benzene |
| SMILES | CCCC1(c2ccc(OC(F)(F)F)cc2)C=CC(c2ccccc2)C=C1 |
| InChI | InChI=1S/C22H21F3O/c1-2-14-21(19-8-10-20(11-9-19)26-22(23,24)25)15-12-18(13-16-21)17-6-4-3-5-7-17/h3-13,15-16,18H,2,14H2,1H3 |
| InChIKey | FNVNMMKJTZHFQN-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|