C23H30N4O2 — CID 70034569
1-[3-[4-[(2R)-2-aminopropanoyl]piperazin-1-yl]propoxy]-4-phenylcyclohexa-2,5-diene-1-carbonitrile (PubChem CID 70034569) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[3-[4-[(2R)-2-aminopropanoyl]piperazin-1-yl]propoxy]-4-phenylcyclohexa-2,5-diene-1-carbonitrile.
| Compound Name | 1-[3-[4-[(2R)-2-aminopropanoyl]piperazin-1-yl]propoxy]-4-phenylcyclohexa-2,5-diene-1-carbonitrile |
|---|---|
| PubChem CID | 70034569 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-[3-[4-[(2R)-2-aminopropanoyl]piperazin-1-yl]propoxy]-4-phenylcyclohexa-2,5-diene-1-carbonitrile |
| SMILES | C[C@@H](N)C(=O)N1CCN(CCCOC2(C#N)C=CC(c3ccccc3)C=C2)CC1 |
| InChI | InChI=1S/C23H30N4O2/c1-19(25)22(28)27-15-13-26(14-16-27)12-5-17-29-23(18-24)10-8-21(9-11-23)20-6-3-2-4-7-20/h2-4,6-11,19,21H,5,12-17,25H2,1H3/t19-,21?,23?/m1/s1 |
| InChIKey | FTFHHOGJWNTFLT-VWRAKTAISA-N |
| XLogP | 2.06 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|