C36H42N2 — CID 19840699
4-[(E)-2-[1-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-4-phenylcyclohexa-2,5-dien-1-yl]ethenyl]-N,N-diethylaniline (PubChem CID 19840699) has the molecular formula C36H42N2 and a molecular weight of 502.75 g/mol. Its IUPAC name is 4-[(E)-2-[1-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-4-phenylcyclohexa-2,5-dien-1-yl]ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[(E)-2-[1-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-4-phenylcyclohexa-2,5-dien-1-yl]ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 19840699 |
| Molecular Formula | C36H42N2 |
| Molecular Weight | 502.75 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | 4-[(E)-2-[1-[(E)-2-[4-(diethylamino)phenyl]ethenyl]-4-phenylcyclohexa-2,5-dien-1-yl]ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/C=C/C2(/C=C/c3ccc(N(CC)CC)cc3)C=CC(c3ccccc3)C=C2)cc1 |
| InChI | InChI=1S/C36H42N2/c1-5-37(6-2)34-18-14-30(15-19-34)22-26-36(28-24-33(25-29-36)32-12-10-9-11-13-32)27-23-31-16-20-35(21-17-31)38(7-3)8-4/h9-29,33H,5-8H2,1-4H3/b26-22+,27-23+ |
| InChIKey | NYHARQNVELGWBO-GEECTANVSA-N |
| XLogP | 9.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.75 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|