About sodium;diphenylmethylbenzene;ethoxyethane
sodium;diphenylmethylbenzene;ethoxyethane (PubChem CID 174702547) has the molecular formula C23H25NaO
and a molecular weight of 340.44 g/mol. Its IUPAC name is sodium;diphenylmethylbenzene;ethoxyethane.
Molecular Properties
| Compound Name | sodium;diphenylmethylbenzene;ethoxyethane |
| PubChem CID | 174702547 |
| Molecular Formula | C23H25NaO |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | sodium;diphenylmethylbenzene;ethoxyethane |
| SMILES | CCOCC.[Na+].c1ccc([C-](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15.C4H10O.Na/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-5-4-2;/h1-15H;3-4H2,1-2H3;/q-1;;+1 |
| InChIKey | XNKOONDHTKNKJP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze sodium;diphenylmethylbenzene;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;diphenylmethylbenzene;ethoxyethane?
The IUPAC name of sodium;diphenylmethylbenzene;ethoxyethane (CID 174702547) is sodium;diphenylmethylbenzene;ethoxyethane.
What is the SMILES notation for sodium;diphenylmethylbenzene;ethoxyethane?
The canonical SMILES for sodium;diphenylmethylbenzene;ethoxyethane is CCOCC.[Na+].c1ccc([C-](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of sodium;diphenylmethylbenzene;ethoxyethane?
The InChIKey is XNKOONDHTKNKJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15.C4H10O.Na/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-5-4-2;/h1-15H;3-4H2,1-2H3;/q-1;;+1.
What are the key properties of sodium;diphenylmethylbenzene;ethoxyethane?
sodium;diphenylmethylbenzene;ethoxyethane has a molecular weight of 340.44 g/mol, XLogP of 2.75, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;diphenylmethylbenzene;ethoxyethane is sourced from PubChem (CID 174702547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).