C27H26NOP — CID 101250444
(3R,3aS,6S)-6-benzyl-2-methyl-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphole 1-oxide (PubChem CID 101250444) has the molecular formula C27H26NOP and a molecular weight of 411.49 g/mol. Its IUPAC name is (3R,3aS,6S)-6-benzyl-2-methyl-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphole 1-oxide.
| Compound Name | (3R,3aS,6S)-6-benzyl-2-methyl-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphole 1-oxide |
|---|---|
| PubChem CID | 101250444 |
| Molecular Formula | C27H26NOP |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (3R,3aS,6S)-6-benzyl-2-methyl-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphole 1-oxide |
| SMILES | CN1[C@@H](c2ccccc2)[C@@H]2C=C[C@H](Cc3ccccc3)C=C2P1(=O)c1ccccc1 |
| InChI | InChI=1S/C27H26NOP/c1-28-27(23-13-7-3-8-14-23)25-18-17-22(19-21-11-5-2-6-12-21)20-26(25)30(28,29)24-15-9-4-10-16-24/h2-18,20,22,25,27H,19H2,1H3/t22-,25-,27+,30?/m1/s1 |
| InChIKey | DDVRGNIFCWYXBF-OUUWUWKBSA-N |
| XLogP | 6.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|