C25H27NO — CID 10882847
(3R,3aR,6R)-6-benzyl-2-tert-butyl-3-phenyl-3a,6-dihydro-3H-isoindol-1-one (PubChem CID 10882847) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is (3R,3aR,6R)-6-benzyl-2-tert-butyl-3-phenyl-3a,6-dihydro-3H-isoindol-1-one.
| Compound Name | (3R,3aR,6R)-6-benzyl-2-tert-butyl-3-phenyl-3a,6-dihydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 10882847 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (3R,3aR,6R)-6-benzyl-2-tert-butyl-3-phenyl-3a,6-dihydro-3H-isoindol-1-one |
| SMILES | CC(C)(C)N1C(=O)C2=C[C@H](Cc3ccccc3)C=C[C@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H27NO/c1-25(2,3)26-23(20-12-8-5-9-13-20)21-15-14-19(17-22(21)24(26)27)16-18-10-6-4-7-11-18/h4-15,17,19,21,23H,16H2,1-3H3/t19-,21+,23-/m0/s1 |
| InChIKey | VNESVJIVBPXBPG-WPYKKVEZSA-N |
| XLogP | 5.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|