C23H24NOP — CID 101250446
(3R,3aS,6S)-2-methyl-1,3-diphenyl-6-prop-2-enyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphole 1-oxide (PubChem CID 101250446) has the molecular formula C23H24NOP and a molecular weight of 361.43 g/mol. Its IUPAC name is (3R,3aS,6S)-2-methyl-1,3-diphenyl-6-prop-2-enyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphole 1-oxide.
| Compound Name | (3R,3aS,6S)-2-methyl-1,3-diphenyl-6-prop-2-enyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphole 1-oxide |
|---|---|
| PubChem CID | 101250446 |
| Molecular Formula | C23H24NOP |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (3R,3aS,6S)-2-methyl-1,3-diphenyl-6-prop-2-enyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphole 1-oxide |
| SMILES | C=CC[C@H]1C=C[C@@H]2C(=C1)P(=O)(c1ccccc1)N(C)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C23H24NOP/c1-3-10-18-15-16-21-22(17-18)26(25,20-13-8-5-9-14-20)24(2)23(21)19-11-6-4-7-12-19/h3-9,11-18,21,23H,1,10H2,2H3/t18-,21+,23-,26?/m0/s1 |
| InChIKey | AKJGRNXARCMNBR-AIOSDDHRSA-N |
| XLogP | 5.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|