C27H31N2O2+ — CID 129430817
2-[(3aR,4R,7R,7aR)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl-dimethyl-prop-2-enylazanium (PubChem CID 129430817) has the molecular formula C27H31N2O2+ and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-[(3aR,4R,7R,7aR)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl-dimethyl-prop-2-enylazanium.
| Compound Name | 2-[(3aR,4R,7R,7aR)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl-dimethyl-prop-2-enylazanium |
|---|---|
| PubChem CID | 129430817 |
| Molecular Formula | C27H31N2O2+ |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 2-[(3aR,4R,7R,7aR)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl-dimethyl-prop-2-enylazanium |
| SMILES | C=CC[N+](C)(C)CCN1C(=O)[C@H]2[C@H](C1=O)[C@H](c1ccccc1)C=C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H31N2O2/c1-4-18-29(2,3)19-17-28-26(30)24-22(20-11-7-5-8-12-20)15-16-23(25(24)27(28)31)21-13-9-6-10-14-21/h4-16,22-25H,1,17-19H2,2-3H3/q+1/t22-,23-,24+,25+/m0/s1 |
| InChIKey | RITVWLKAXUJITM-CXSMSNRLSA-N |
| XLogP | 3.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|