C26H30N3O3+ — CID 98054387
2-[(3aR,4R,7S,7aS)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl-(2-amino-2-oxoethyl)-dimethylazanium (PubChem CID 98054387) has the molecular formula C26H30N3O3+ and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-[(3aR,4R,7S,7aS)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl-(2-amino-2-oxoethyl)-dimethylazanium.
| Compound Name | 2-[(3aR,4R,7S,7aS)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl-(2-amino-2-oxoethyl)-dimethylazanium |
|---|---|
| PubChem CID | 98054387 |
| Molecular Formula | C26H30N3O3+ |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-[(3aR,4R,7S,7aS)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl-(2-amino-2-oxoethyl)-dimethylazanium |
| SMILES | C[N+](C)(CCN1C(=O)[C@@H]2[C@H](C1=O)[C@H](c1ccccc1)C=C[C@@H]2c1ccccc1)CC(N)=O |
| InChI | InChI=1S/C26H29N3O3/c1-29(2,17-22(27)30)16-15-28-25(31)23-20(18-9-5-3-6-10-18)13-14-21(24(23)26(28)32)19-11-7-4-8-12-19/h3-14,20-21,23-24H,15-17H2,1-2H3,(H-,27,30)/p+1/t20-,21+,23+,24- |
| InChIKey | NKQOYDGTAIUCLY-COSOUPRKSA-O |
| XLogP | 2.29 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|