C27H29N2O2+ — CID 124628669
2-[(3aR,4R,7R,7aS)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl-dimethyl-prop-2-ynylazanium (PubChem CID 124628669) has the molecular formula C27H29N2O2+ and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-[(3aR,4R,7R,7aS)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl-dimethyl-prop-2-ynylazanium.
| Compound Name | 2-[(3aR,4R,7R,7aS)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl-dimethyl-prop-2-ynylazanium |
|---|---|
| PubChem CID | 124628669 |
| Molecular Formula | C27H29N2O2+ |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 2-[(3aR,4R,7R,7aS)-1,3-dioxo-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindol-2-yl]ethyl-dimethyl-prop-2-ynylazanium |
| SMILES | C#CC[N+](C)(C)CCN1C(=O)[C@@H]2[C@H](C1=O)[C@H](c1ccccc1)C=C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H29N2O2/c1-4-18-29(2,3)19-17-28-26(30)24-22(20-11-7-5-8-12-20)15-16-23(25(24)27(28)31)21-13-9-6-10-14-21/h1,5-16,22-25H,17-19H2,2-3H3/q+1/t22-,23-,24-,25+/m0/s1 |
| InChIKey | WQMGCNYUPXJMEE-OJJQZRKESA-N |
| XLogP | 3.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|