C33H30NO2P — CID 11038440
(S)-[(1R,3S,3aR,6R)-2-benzyl-1-oxo-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphol-6-yl]-phenylmethanol (PubChem CID 11038440) has the molecular formula C33H30NO2P and a molecular weight of 503.58 g/mol. Its IUPAC name is (S)-[(1R,3S,3aR,6R)-2-benzyl-1-oxo-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphol-6-yl]-phenylmethanol.
| Compound Name | (S)-[(1R,3S,3aR,6R)-2-benzyl-1-oxo-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphol-6-yl]-phenylmethanol |
|---|---|
| PubChem CID | 11038440 |
| Molecular Formula | C33H30NO2P |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | (S)-[(1R,3S,3aR,6R)-2-benzyl-1-oxo-1,3-diphenyl-3a,6-dihydro-3H-2,1λ5-benzazaphosphol-6-yl]-phenylmethanol |
| SMILES | O=[P@]1(c2ccccc2)C2=C[C@H]([C@H](O)c3ccccc3)C=C[C@@H]2[C@@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C33H30NO2P/c35-33(27-17-9-3-10-18-27)28-21-22-30-31(23-28)37(36,29-19-11-4-12-20-29)34(24-25-13-5-1-6-14-25)32(30)26-15-7-2-8-16-26/h1-23,28,30,32-33,35H,24H2/t28-,30+,32-,33-,37-/m1/s1 |
| InChIKey | SEIANYLZVFWKPT-HEPPQQCMSA-N |
| XLogP | 7.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|