C26H22NOP — CID 23420649
(1R,3R)-2-benzyl-1,3-diphenyl-3H-2,1λ5-benzazaphosphole 1-oxide (PubChem CID 23420649) has the molecular formula C26H22NOP and a molecular weight of 395.44 g/mol. Its IUPAC name is (1R,3R)-2-benzyl-1,3-diphenyl-3H-2,1λ5-benzazaphosphole 1-oxide.
| Compound Name | (1R,3R)-2-benzyl-1,3-diphenyl-3H-2,1λ5-benzazaphosphole 1-oxide |
|---|---|
| PubChem CID | 23420649 |
| Molecular Formula | C26H22NOP |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (1R,3R)-2-benzyl-1,3-diphenyl-3H-2,1λ5-benzazaphosphole 1-oxide |
| SMILES | O=[P@]1(c2ccccc2)c2ccccc2[C@@H](c2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H22NOP/c28-29(23-16-8-3-9-17-23)25-19-11-10-18-24(25)26(22-14-6-2-7-15-22)27(29)20-21-12-4-1-5-13-21/h1-19,26H,20H2/t26-,29-/m1/s1 |
| InChIKey | OGHQOUGCHNXMNY-GGXMVOPNSA-N |
| XLogP | 5.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|