C23H24NOP — CID 10915400
(1R,3S)-2-tert-butyl-1,3-diphenyl-3H-2,1lambda5-benzazaphosphole 1-oxide (PubChem CID 10915400) has the molecular formula C23H24NOP and a molecular weight of 361.43 g/mol. Its IUPAC name is (1R,3S)-2-tert-butyl-1,3-diphenyl-3H-2,1lambda5-benzazaphosphole 1-oxide.
| Compound Name | (1R,3S)-2-tert-butyl-1,3-diphenyl-3H-2,1lambda5-benzazaphosphole 1-oxide |
|---|---|
| PubChem CID | 10915400 |
| Molecular Formula | C23H24NOP |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (1R,3S)-2-tert-butyl-1,3-diphenyl-3H-2,1lambda5-benzazaphosphole 1-oxide |
| SMILES | CC(C)(C)N1[C@@H](c2ccccc2)c2ccccc2[P@]1(=O)c1ccccc1 |
| InChI | InChI=1S/C23H24NOP/c1-23(2,3)24-22(18-12-6-4-7-13-18)20-16-10-11-17-21(20)26(24,25)19-14-8-5-9-15-19/h4-17,22H,1-3H3/t22-,26+/m0/s1 |
| InChIKey | WWOYQKACIJSUKA-BKMJKUGQSA-N |
| XLogP | 5.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|