C16H23NO2 — CID 176760746
(4S)-4-benzyl-3-tert-butyl-5,5-dimethyl-1,3-oxazolidin-2-one (PubChem CID 176760746) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (4S)-4-benzyl-3-tert-butyl-5,5-dimethyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-tert-butyl-5,5-dimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 176760746 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (4S)-4-benzyl-3-tert-butyl-5,5-dimethyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC(=O)N(C(C)(C)C)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-15(2,3)17-13(16(4,5)19-14(17)18)11-12-9-7-6-8-10-12/h6-10,13H,11H2,1-5H3/t13-/m0/s1 |
| InChIKey | RAVISRAJCLHFKR-ZDUSSCGKSA-N |
| XLogP | 3.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |