C18H26N2O2 — CID 139184480
2-benzyl-1,3-ditert-butylimidazolidine-4,5-dione (PubChem CID 139184480) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-benzyl-1,3-ditert-butylimidazolidine-4,5-dione.
| Compound Name | 2-benzyl-1,3-ditert-butylimidazolidine-4,5-dione |
|---|---|
| PubChem CID | 139184480 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2-benzyl-1,3-ditert-butylimidazolidine-4,5-dione |
| SMILES | CC(C)(C)N1C(=O)C(=O)N(C(C)(C)C)C1Cc1ccccc1 |
| InChI | InChI=1S/C18H26N2O2/c1-17(2,3)19-14(12-13-10-8-7-9-11-13)20(18(4,5)6)16(22)15(19)21/h7-11,14H,12H2,1-6H3 |
| InChIKey | KPQNKCWJDMFRKI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|