C15H21N2O — CID 135021308
CID 135021308 (PubChem CID 135021308) has the molecular formula C15H21N2O and a molecular weight of 245.35 g/mol.
| Compound Name | CID 135021308 |
|---|---|
| PubChem CID | 135021308 |
| Molecular Formula | C15H21N2O |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | — |
| SMILES | CN1C(=O)[C@@H](Cc2ccccc2)[N][C@H]1C(C)(C)C |
| InChI | InChI=1S/C15H21N2O/c1-15(2,3)14-16-12(13(18)17(14)4)10-11-8-6-5-7-9-11/h5-9,12,14H,10H2,1-4H3/t12-,14-/m1/s1 |
| InChIKey | RKCGMBYVFWJQPE-TZMCWYRMSA-N |
| XLogP | 2.05 |
| TPSA | 34.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |