C10H8Cl2N2O2 — CID 25223546
(5S)-5-benzyl-1,3-dichloroimidazolidine-2,4-dione (PubChem CID 25223546) has the molecular formula C10H8Cl2N2O2 and a molecular weight of 259.09 g/mol. Its IUPAC name is (5S)-5-benzyl-1,3-dichloroimidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-1,3-dichloroimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 25223546 |
| Molecular Formula | C10H8Cl2N2O2 |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | (5S)-5-benzyl-1,3-dichloroimidazolidine-2,4-dione |
| SMILES | O=C1[C@H](Cc2ccccc2)N(Cl)C(=O)N1Cl |
| InChI | InChI=1S/C10H8Cl2N2O2/c11-13-8(9(15)14(12)10(13)16)6-7-4-2-1-3-5-7/h1-5,8H,6H2/t8-/m0/s1 |
| InChIKey | ZRLYAQVCJNRJKV-QMMMGPOBSA-N |
| XLogP | 2.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|