C23H22N2O — CID 12013114
(5S)-1,5-dibenzyl-2-phenylimidazolidin-4-one (PubChem CID 12013114) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is (5S)-1,5-dibenzyl-2-phenylimidazolidin-4-one.
| Compound Name | (5S)-1,5-dibenzyl-2-phenylimidazolidin-4-one |
|---|---|
| PubChem CID | 12013114 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (5S)-1,5-dibenzyl-2-phenylimidazolidin-4-one |
| SMILES | O=C1NC(c2ccccc2)N(Cc2ccccc2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H22N2O/c26-23-21(16-18-10-4-1-5-11-18)25(17-19-12-6-2-7-13-19)22(24-23)20-14-8-3-9-15-20/h1-15,21-22H,16-17H2,(H,24,26)/t21-,22?/m0/s1 |
| InChIKey | YAFRKMUBGODFTP-HMTLIYDFSA-N |
| XLogP | 3.93 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |