C17H17NO3S — CID 53240197
(3S)-2,3-dibenzyl-1,1-dioxo-1,2-thiazolidin-4-one (PubChem CID 53240197) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is (3S)-2,3-dibenzyl-1,1-dioxo-1,2-thiazolidin-4-one.
| Compound Name | (3S)-2,3-dibenzyl-1,1-dioxo-1,2-thiazolidin-4-one |
|---|---|
| PubChem CID | 53240197 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (3S)-2,3-dibenzyl-1,1-dioxo-1,2-thiazolidin-4-one |
| SMILES | O=C1CS(=O)(=O)N(Cc2ccccc2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H17NO3S/c19-17-13-22(20,21)18(12-15-9-5-2-6-10-15)16(17)11-14-7-3-1-4-8-14/h1-10,16H,11-13H2/t16-/m0/s1 |
| InChIKey | GKYVZBXZXSZDRK-INIZCTEOSA-N |
| XLogP | 2.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |