C19H19NO3S — CID 175084249
4-benzyl-5,5-dimethyl-3-(3-thiophen-2-ylprop-2-enoyl)-1,3-oxazolidin-2-one (PubChem CID 175084249) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is 4-benzyl-5,5-dimethyl-3-(3-thiophen-2-ylprop-2-enoyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-5,5-dimethyl-3-(3-thiophen-2-ylprop-2-enoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 175084249 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-benzyl-5,5-dimethyl-3-(3-thiophen-2-ylprop-2-enoyl)-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC(=O)N(C(=O)C=Cc2cccs2)C1Cc1ccccc1 |
| InChI | InChI=1S/C19H19NO3S/c1-19(2)16(13-14-7-4-3-5-8-14)20(18(22)23-19)17(21)11-10-15-9-6-12-24-15/h3-12,16H,13H2,1-2H3 |
| InChIKey | KLVLJJZKWBZYRD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|