C38H48NO2PSi — CID 102375429
trimethyl-[(2R)-2,3,3-trimethyl-1-[(4S,5R)-4-methyl-2-oxo-5-phenyl-3-trityl-1,3,2λ5-oxazaphospholidin-2-yl]butyl]silane (PubChem CID 102375429) has the molecular formula C38H48NO2PSi and a molecular weight of 609.87 g/mol. Its IUPAC name is trimethyl-[(2R)-2,3,3-trimethyl-1-[(4S,5R)-4-methyl-2-oxo-5-phenyl-3-trityl-1,3,2λ5-oxazaphospholidin-2-yl]butyl]silane.
| Compound Name | trimethyl-[(2R)-2,3,3-trimethyl-1-[(4S,5R)-4-methyl-2-oxo-5-phenyl-3-trityl-1,3,2λ5-oxazaphospholidin-2-yl]butyl]silane |
|---|---|
| PubChem CID | 102375429 |
| Molecular Formula | C38H48NO2PSi |
| Molecular Weight | 609.87 g/mol |
| Exact Mass | 609.32 |
| IUPAC Name | trimethyl-[(2R)-2,3,3-trimethyl-1-[(4S,5R)-4-methyl-2-oxo-5-phenyl-3-trityl-1,3,2λ5-oxazaphospholidin-2-yl]butyl]silane |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OP(=O)(C([C@H](C)C(C)(C)C)[Si](C)(C)C)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H48NO2PSi/c1-29(37(3,4)5)36(43(6,7)8)42(40)39(30(2)35(41-42)31-21-13-9-14-22-31)38(32-23-15-10-16-24-32,33-25-17-11-18-26-33)34-27-19-12-20-28-34/h9-30,35-36H,1-8H3/t29-,30-,35-,36?,42?/m0/s1 |
| InChIKey | KYLCBSARAYHIEV-VFLCRPARSA-N |
| XLogP | 10.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.87 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|