C37H46NO2PSi — CID 11410807
[(2R)-2,3-dimethyl-1-[(2R,4S,5R)-4-methyl-2-oxo-5-phenyl-3-trityl-1,3,2λ5-oxazaphospholidin-2-yl]butyl]-trimethylsilane (PubChem CID 11410807) has the molecular formula C37H46NO2PSi and a molecular weight of 595.84 g/mol. Its IUPAC name is [(2R)-2,3-dimethyl-1-[(2R,4S,5R)-4-methyl-2-oxo-5-phenyl-3-trityl-1,3,2λ5-oxazaphospholidin-2-yl]butyl]-trimethylsilane.
| Compound Name | [(2R)-2,3-dimethyl-1-[(2R,4S,5R)-4-methyl-2-oxo-5-phenyl-3-trityl-1,3,2λ5-oxazaphospholidin-2-yl]butyl]-trimethylsilane |
|---|---|
| PubChem CID | 11410807 |
| Molecular Formula | C37H46NO2PSi |
| Molecular Weight | 595.84 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | [(2R)-2,3-dimethyl-1-[(2R,4S,5R)-4-methyl-2-oxo-5-phenyl-3-trityl-1,3,2λ5-oxazaphospholidin-2-yl]butyl]-trimethylsilane |
| SMILES | CC(C)[C@@H](C)C([Si](C)(C)C)[P@@]1(=O)O[C@H](c2ccccc2)[C@H](C)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H46NO2PSi/c1-28(2)29(3)36(42(5,6)7)41(39)38(30(4)35(40-41)31-20-12-8-13-21-31)37(32-22-14-9-15-23-32,33-24-16-10-17-25-33)34-26-18-11-19-27-34/h8-30,35-36H,1-7H3/t29-,30+,35+,36?,41-/m1/s1 |
| InChIKey | XXNZMYFERNDPJK-CADXKIHESA-N |
| XLogP | 10.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.84 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|