C21H25NO — CID 92856808
(R)-[(2R,3R)-1-cyclohexyl-3-phenylaziridin-2-yl]-phenylmethanol (PubChem CID 92856808) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is (R)-[(2R,3R)-1-cyclohexyl-3-phenylaziridin-2-yl]-phenylmethanol.
| Compound Name | (R)-[(2R,3R)-1-cyclohexyl-3-phenylaziridin-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 92856808 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (R)-[(2R,3R)-1-cyclohexyl-3-phenylaziridin-2-yl]-phenylmethanol |
| SMILES | O[C@H](c1ccccc1)[C@H]1[C@@H](c2ccccc2)N1C1CCCCC1 |
| InChI | InChI=1S/C21H25NO/c23-21(17-12-6-2-7-13-17)20-19(16-10-4-1-5-11-16)22(20)18-14-8-3-9-15-18/h1-2,4-7,10-13,18-21,23H,3,8-9,14-15H2/t19-,20-,21-,22?/m1/s1 |
| InChIKey | BVEXGQHOBZRFGZ-NJTYFVPYSA-N |
| XLogP | 4.48 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|