C19H29NO4SSi — CID 6610189
ethyl 2-phenyl-1-(2-trimethylsilylethylsulfonyl)-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 6610189) has the molecular formula C19H29NO4SSi and a molecular weight of 395.60 g/mol. Its IUPAC name is ethyl 2-phenyl-1-(2-trimethylsilylethylsulfonyl)-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | ethyl 2-phenyl-1-(2-trimethylsilylethylsulfonyl)-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 6610189 |
| Molecular Formula | C19H29NO4SSi |
| Molecular Weight | 395.60 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | ethyl 2-phenyl-1-(2-trimethylsilylethylsulfonyl)-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=CCC(c2ccccc2)N(S(=O)(=O)CC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C19H29NO4SSi/c1-5-24-19(21)17-11-12-18(16-9-7-6-8-10-16)20(15-17)25(22,23)13-14-26(2,3)4/h6-11,18H,5,12-15H2,1-4H3 |
| InChIKey | QUTFMMPOZFBIMW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|