C28H33NO4SSi — CID 134978017
ethyl (2R,5R)-2-naphthalen-1-yl-5-phenyl-1-(2-trimethylsilylethylsulfonyl)-2,5-dihydropyrrole-3-carboxylate (PubChem CID 134978017) has the molecular formula C28H33NO4SSi and a molecular weight of 507.73 g/mol. Its IUPAC name is ethyl (2R,5R)-2-naphthalen-1-yl-5-phenyl-1-(2-trimethylsilylethylsulfonyl)-2,5-dihydropyrrole-3-carboxylate.
| Compound Name | ethyl (2R,5R)-2-naphthalen-1-yl-5-phenyl-1-(2-trimethylsilylethylsulfonyl)-2,5-dihydropyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134978017 |
| Molecular Formula | C28H33NO4SSi |
| Molecular Weight | 507.73 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | ethyl (2R,5R)-2-naphthalen-1-yl-5-phenyl-1-(2-trimethylsilylethylsulfonyl)-2,5-dihydropyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H](c2ccccc2)N(S(=O)(=O)CC[Si](C)(C)C)[C@@H]1c1cccc2ccccc12 |
| InChI | InChI=1S/C28H33NO4SSi/c1-5-33-28(30)25-20-26(22-13-7-6-8-14-22)29(34(31,32)18-19-35(2,3)4)27(25)24-17-11-15-21-12-9-10-16-23(21)24/h6-17,20,26-27H,5,18-19H2,1-4H3/t26-,27-/m1/s1 |
| InChIKey | PGCPLSAMQMLQKC-KAYWLYCHSA-N |
| XLogP | 6.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.73 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|