C15H23NO4SSi — CID 15370769
methyl 3-phenyl-1-(2-trimethylsilylethylsulfonyl)aziridine-2-carboxylate (PubChem CID 15370769) has the molecular formula C15H23NO4SSi and a molecular weight of 341.51 g/mol. Its IUPAC name is methyl 3-phenyl-1-(2-trimethylsilylethylsulfonyl)aziridine-2-carboxylate.
| Compound Name | methyl 3-phenyl-1-(2-trimethylsilylethylsulfonyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 15370769 |
| Molecular Formula | C15H23NO4SSi |
| Molecular Weight | 341.51 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | methyl 3-phenyl-1-(2-trimethylsilylethylsulfonyl)aziridine-2-carboxylate |
| SMILES | COC(=O)C1C(c2ccccc2)N1S(=O)(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C15H23NO4SSi/c1-20-15(17)14-13(12-8-6-5-7-9-12)16(14)21(18,19)10-11-22(2,3)4/h5-9,13-14H,10-11H2,1-4H3 |
| InChIKey | ZGEBPIMPQKTONZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|