C20H33NO4SSi — CID 101069850
benzyl 2-[(2S,6S)-6-methyl-1-(2-trimethylsilylethylsulfonyl)piperidin-2-yl]acetate (PubChem CID 101069850) has the molecular formula C20H33NO4SSi and a molecular weight of 411.64 g/mol. Its IUPAC name is benzyl 2-[(2S,6S)-6-methyl-1-(2-trimethylsilylethylsulfonyl)piperidin-2-yl]acetate.
| Compound Name | benzyl 2-[(2S,6S)-6-methyl-1-(2-trimethylsilylethylsulfonyl)piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 101069850 |
| Molecular Formula | C20H33NO4SSi |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | benzyl 2-[(2S,6S)-6-methyl-1-(2-trimethylsilylethylsulfonyl)piperidin-2-yl]acetate |
| SMILES | C[C@H]1CCC[C@@H](CC(=O)OCc2ccccc2)N1S(=O)(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C20H33NO4SSi/c1-17-9-8-12-19(21(17)26(23,24)13-14-27(2,3)4)15-20(22)25-16-18-10-6-5-7-11-18/h5-7,10-11,17,19H,8-9,12-16H2,1-4H3/t17-,19-/m0/s1 |
| InChIKey | ONPOYDFPIWJOTD-HKUYNNGSSA-N |
| XLogP | 4.03 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|