C19H25NO2SSi — CID 10498694
2-[(2R,3R)-2,3-diphenylaziridin-1-yl]sulfonylethyl-trimethylsilane (PubChem CID 10498694) has the molecular formula C19H25NO2SSi and a molecular weight of 359.57 g/mol. Its IUPAC name is 2-[(2R,3R)-2,3-diphenylaziridin-1-yl]sulfonylethyl-trimethylsilane.
| Compound Name | 2-[(2R,3R)-2,3-diphenylaziridin-1-yl]sulfonylethyl-trimethylsilane |
|---|---|
| PubChem CID | 10498694 |
| Molecular Formula | C19H25NO2SSi |
| Molecular Weight | 359.57 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-[(2R,3R)-2,3-diphenylaziridin-1-yl]sulfonylethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCS(=O)(=O)N1[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H25NO2SSi/c1-24(2,3)15-14-23(21,22)20-18(16-10-6-4-7-11-16)19(20)17-12-8-5-9-13-17/h4-13,18-19H,14-15H2,1-3H3/t18-,19-/m1/s1 |
| InChIKey | JGZZGXMVIUKYQA-RTBURBONSA-N |
| XLogP | 4.45 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|