C37H47NO8S2Si — CID 101050491
methyl (4aS,6R,7S,8S,8aR)-3-methyl-7,8-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-(2-trimethylsilylethylsulfonyl)-6,7,8,8a-tetrahydro-4aH-pyrano[3,2-b][1,4]thiazine-2-carboxylate (PubChem CID 101050491) has the molecular formula C37H47NO8S2Si and a molecular weight of 726.00 g/mol. Its IUPAC name is methyl (4aS,6R,7S,8S,8aR)-3-methyl-7,8-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-(2-trimethylsilylethylsulfonyl)-6,7,8,8a-tetrahydro-4aH-pyrano[3,2-b][1,4]thiazine-2-carboxylate.
| Compound Name | methyl (4aS,6R,7S,8S,8aR)-3-methyl-7,8-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-(2-trimethylsilylethylsulfonyl)-6,7,8,8a-tetrahydro-4aH-pyrano[3,2-b][1,4]thiazine-2-carboxylate |
|---|---|
| PubChem CID | 101050491 |
| Molecular Formula | C37H47NO8S2Si |
| Molecular Weight | 726.00 g/mol |
| Exact Mass | 725.25 |
| IUPAC Name | methyl (4aS,6R,7S,8S,8aR)-3-methyl-7,8-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-(2-trimethylsilylethylsulfonyl)-6,7,8,8a-tetrahydro-4aH-pyrano[3,2-b][1,4]thiazine-2-carboxylate |
| SMILES | COC(=O)C1=C(C)N(S(=O)(=O)CC[Si](C)(C)C)[C@H]2O[C@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2S1 |
| InChI | InChI=1S/C37H47NO8S2Si/c1-27-34(37(39)42-2)47-35-33(45-25-30-19-13-8-14-20-30)32(44-24-29-17-11-7-12-18-29)31(26-43-23-28-15-9-6-10-16-28)46-36(35)38(27)48(40,41)21-22-49(3,4)5/h6-20,31-33,35-36H,21-26H2,1-5H3/t31-,32+,33+,35-,36+/m1/s1 |
| InChIKey | NSCQPLWDNVBZDO-HTQIHCHASA-N |
| XLogP | 6.59 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.00 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|