C33H41NO5 — CID 15371070
(2R,3S,4R,5S)-N-hexyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carboxamide (PubChem CID 15371070) has the molecular formula C33H41NO5 and a molecular weight of 531.69 g/mol. Its IUPAC name is (2R,3S,4R,5S)-N-hexyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-N-hexyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 15371070 |
| Molecular Formula | C33H41NO5 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | (2R,3S,4R,5S)-N-hexyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolane-2-carboxamide |
| SMILES | CCCCCCNC(=O)[C@@H]1O[C@@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H41NO5/c1-2-3-4-14-21-34-33(35)32-31(38-24-28-19-12-7-13-20-28)30(37-23-27-17-10-6-11-18-27)29(39-32)25-36-22-26-15-8-5-9-16-26/h5-13,15-20,29-32H,2-4,14,21-25H2,1H3,(H,34,35)/t29-,30+,31-,32+/m0/s1 |
| InChIKey | BKLCGHQIMIETDE-MLMSKLGMSA-N |
| XLogP | 5.84 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|