C19H21NO2SSi — CID 101176254
2-[(2R,3S)-1-(benzenesulfonyl)-3-phenylaziridin-2-yl]ethynyl-trimethylsilane (PubChem CID 101176254) has the molecular formula C19H21NO2SSi and a molecular weight of 355.54 g/mol. Its IUPAC name is 2-[(2R,3S)-1-(benzenesulfonyl)-3-phenylaziridin-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(2R,3S)-1-(benzenesulfonyl)-3-phenylaziridin-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 101176254 |
| Molecular Formula | C19H21NO2SSi |
| Molecular Weight | 355.54 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[(2R,3S)-1-(benzenesulfonyl)-3-phenylaziridin-2-yl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#C[C@@H]1[C@H](c2ccccc2)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H21NO2SSi/c1-24(2,3)15-14-18-19(16-10-6-4-7-11-16)20(18)23(21,22)17-12-8-5-9-13-17/h4-13,18-19H,1-3H3/t18-,19+,20?/m1/s1 |
| InChIKey | XEYQIUDZZBLIAB-LFPSWIHMSA-N |
| XLogP | 3.68 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|