C20H29NO2SSi — CID 11111578
2-[(2R,3S)-3-cyclohexyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]ethynyl-trimethylsilane (PubChem CID 11111578) has the molecular formula C20H29NO2SSi and a molecular weight of 375.61 g/mol. Its IUPAC name is 2-[(2R,3S)-3-cyclohexyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(2R,3S)-3-cyclohexyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11111578 |
| Molecular Formula | C20H29NO2SSi |
| Molecular Weight | 375.61 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 2-[(2R,3S)-3-cyclohexyl-1-(4-methylphenyl)sulfonylaziridin-2-yl]ethynyl-trimethylsilane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](C#C[Si](C)(C)C)[C@@H]2C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H29NO2SSi/c1-16-10-12-18(13-11-16)24(22,23)21-19(14-15-25(2,3)4)20(21)17-8-6-5-7-9-17/h10-13,17,19-20H,5-9H2,1-4H3/t19-,20+,21?/m1/s1 |
| InChIKey | FWACGARZUSZPSP-PDYHCXRVSA-N |
| XLogP | 4.20 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|