C20H22ClNO2SSi — CID 10621217
2-[(2R,3R)-3-(4-chlorophenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]ethynyl-trimethylsilane (PubChem CID 10621217) has the molecular formula C20H22ClNO2SSi and a molecular weight of 404.01 g/mol. Its IUPAC name is 2-[(2R,3R)-3-(4-chlorophenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(2R,3R)-3-(4-chlorophenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 10621217 |
| Molecular Formula | C20H22ClNO2SSi |
| Molecular Weight | 404.01 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-[(2R,3R)-3-(4-chlorophenyl)-1-(4-methylphenyl)sulfonylaziridin-2-yl]ethynyl-trimethylsilane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](C#C[Si](C)(C)C)[C@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H22ClNO2SSi/c1-15-5-11-18(12-6-15)25(23,24)22-19(13-14-26(2,3)4)20(22)16-7-9-17(21)10-8-16/h5-12,19-20H,1-4H3/t19-,20-,22?/m1/s1 |
| InChIKey | KSZQZILYZWUFCO-JLMWTWJWSA-N |
| XLogP | 4.64 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.01 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|