C19H28ClNO2S — CID 45258802
(2S,3R)-3-[(1R)-1-chloroethyl]-2-cyclohexyl-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 45258802) has the molecular formula C19H28ClNO2S and a molecular weight of 369.96 g/mol. Its IUPAC name is (2S,3R)-3-[(1R)-1-chloroethyl]-2-cyclohexyl-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | (2S,3R)-3-[(1R)-1-chloroethyl]-2-cyclohexyl-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 45258802 |
| Molecular Formula | C19H28ClNO2S |
| Molecular Weight | 369.96 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (2S,3R)-3-[(1R)-1-chloroethyl]-2-cyclohexyl-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H]([C@@H](C)Cl)[C@@H]2C2CCCCC2)cc1 |
| InChI | InChI=1S/C19H28ClNO2S/c1-14-8-10-17(11-9-14)24(22,23)21-13-12-18(15(2)20)19(21)16-6-4-3-5-7-16/h8-11,15-16,18-19H,3-7,12-13H2,1-2H3/t15-,18+,19+/m1/s1 |
| InChIKey | RCARIDPWYFRQAS-MNEFBYGVSA-N |
| XLogP | 4.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.96 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|