C16H18BBrN2O4S2 — CID 14940738
(4R,5R)-2-bromo-1,3-bis(methylsulfonyl)-4,5-diphenyl-1,3,2-diazaborolidine (PubChem CID 14940738) has the molecular formula C16H18BBrN2O4S2 and a molecular weight of 457.18 g/mol. Its IUPAC name is (4R,5R)-2-bromo-1,3-bis(methylsulfonyl)-4,5-diphenyl-1,3,2-diazaborolidine.
| Compound Name | (4R,5R)-2-bromo-1,3-bis(methylsulfonyl)-4,5-diphenyl-1,3,2-diazaborolidine |
|---|---|
| PubChem CID | 14940738 |
| Molecular Formula | C16H18BBrN2O4S2 |
| Molecular Weight | 457.18 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | (4R,5R)-2-bromo-1,3-bis(methylsulfonyl)-4,5-diphenyl-1,3,2-diazaborolidine |
| SMILES | CS(=O)(=O)N1B(Br)N(S(C)(=O)=O)[C@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H18BBrN2O4S2/c1-25(21,22)19-15(13-9-5-3-6-10-13)16(14-11-7-4-8-12-14)20(17(19)18)26(2,23)24/h3-12,15-16H,1-2H3/t15-,16-/m1/s1 |
| InChIKey | FAINWDZNHGJHIS-HZPDHXFCSA-N |
| XLogP | 2.39 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|