C32H33BN2O4S2 — CID 134906244
(4R,5R)-1,3-bis-(4-methylphenyl)sulfonyl-2-(2-methylprop-2-enyl)-4,5-diphenyl-1,3,2-diazaborolidine (PubChem CID 134906244) has the molecular formula C32H33BN2O4S2 and a molecular weight of 584.57 g/mol. Its IUPAC name is (4R,5R)-1,3-bis-(4-methylphenyl)sulfonyl-2-(2-methylprop-2-enyl)-4,5-diphenyl-1,3,2-diazaborolidine.
| Compound Name | (4R,5R)-1,3-bis-(4-methylphenyl)sulfonyl-2-(2-methylprop-2-enyl)-4,5-diphenyl-1,3,2-diazaborolidine |
|---|---|
| PubChem CID | 134906244 |
| Molecular Formula | C32H33BN2O4S2 |
| Molecular Weight | 584.57 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | (4R,5R)-1,3-bis-(4-methylphenyl)sulfonyl-2-(2-methylprop-2-enyl)-4,5-diphenyl-1,3,2-diazaborolidine |
| SMILES | C=C(C)CB1N(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccccc2)[C@@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H33BN2O4S2/c1-24(2)23-33-34(40(36,37)29-19-15-25(3)16-20-29)31(27-11-7-5-8-12-27)32(28-13-9-6-10-14-28)35(33)41(38,39)30-21-17-26(4)18-22-30/h5-22,31-32H,1,23H2,2-4H3/t31-,32-/m1/s1 |
| InChIKey | NEVYTFRHLNPYJT-ROJLCIKYSA-N |
| XLogP | 6.55 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.57 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|