C18H18O2 — CID 54095023
(R)-[(1S,5R)-6-oxabicyclo[3.1.0]hexan-3-yl]-(4-phenylphenyl)methanol (PubChem CID 54095023) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (R)-[(1S,5R)-6-oxabicyclo[3.1.0]hexan-3-yl]-(4-phenylphenyl)methanol.
| Compound Name | (R)-[(1S,5R)-6-oxabicyclo[3.1.0]hexan-3-yl]-(4-phenylphenyl)methanol |
|---|---|
| PubChem CID | 54095023 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (R)-[(1S,5R)-6-oxabicyclo[3.1.0]hexan-3-yl]-(4-phenylphenyl)methanol |
| SMILES | O[C@@H](c1ccc(-c2ccccc2)cc1)C1C[C@@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C18H18O2/c19-18(15-10-16-17(11-15)20-16)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,15-19H,10-11H2/t15?,16-,17+,18-/m0/s1 |
| InChIKey | MWNKZKBTHCWQFO-FBVQUNGASA-N |
| XLogP | 3.56 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|