C12H14N2O3S — CID 11265602
(5S)-5-ethenyl-1-(4-methylphenyl)sulfonylimidazolidin-2-one (PubChem CID 11265602) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is (5S)-5-ethenyl-1-(4-methylphenyl)sulfonylimidazolidin-2-one.
| Compound Name | (5S)-5-ethenyl-1-(4-methylphenyl)sulfonylimidazolidin-2-one |
|---|---|
| PubChem CID | 11265602 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (5S)-5-ethenyl-1-(4-methylphenyl)sulfonylimidazolidin-2-one |
| SMILES | C=C[C@H]1CNC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H14N2O3S/c1-3-10-8-13-12(15)14(10)18(16,17)11-6-4-9(2)5-7-11/h3-7,10H,1,8H2,2H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | KVTRNNVIOVCYOI-JTQLQIEISA-N |
| XLogP | 1.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|