C20H21NO4S — CID 85109223
5-benzyl-4-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazinan-2-one (PubChem CID 85109223) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is 5-benzyl-4-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazinan-2-one.
| Compound Name | 5-benzyl-4-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 85109223 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 5-benzyl-4-ethenyl-3-(4-methylphenyl)sulfonyl-1,3-oxazinan-2-one |
| SMILES | C=CC1C(Cc2ccccc2)COC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21NO4S/c1-3-19-17(13-16-7-5-4-6-8-16)14-25-20(22)21(19)26(23,24)18-11-9-15(2)10-12-18/h3-12,17,19H,1,13-14H2,2H3 |
| InChIKey | WWCBCFLBBIGFSG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|