C14H21ClN2O4S — CID 110191794
trimethyl-[[(5S)-3-(4-methylphenyl)sulfonyl-2-oxo-1,3-oxazolidin-5-yl]methyl]azanium chloride (PubChem CID 110191794) has the molecular formula C14H21ClN2O4S and a molecular weight of 348.85 g/mol. Its IUPAC name is trimethyl-[[(5S)-3-(4-methylphenyl)sulfonyl-2-oxo-1,3-oxazolidin-5-yl]methyl]azanium chloride.
| Compound Name | trimethyl-[[(5S)-3-(4-methylphenyl)sulfonyl-2-oxo-1,3-oxazolidin-5-yl]methyl]azanium chloride |
|---|---|
| PubChem CID | 110191794 |
| Molecular Formula | C14H21ClN2O4S |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | trimethyl-[[(5S)-3-(4-methylphenyl)sulfonyl-2-oxo-1,3-oxazolidin-5-yl]methyl]azanium chloride |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](C[N+](C)(C)C)OC2=O)cc1.[Cl-] |
| InChI | InChI=1S/C14H21N2O4S.ClH/c1-11-5-7-13(8-6-11)21(18,19)15-9-12(20-14(15)17)10-16(2,3)4;/h5-8,12H,9-10H2,1-4H3;1H/q+1;/p-1/t12-;/m1./s1 |
| InChIKey | FVXRAFKIBRWMEK-UTONKHPSSA-M |
| XLogP | -1.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|