C26H25NO3S — CID 177419334
(4S,5R)-5-ethenyl-7-methyl-1-(4-methylphenyl)sulfonyl-4-phenyl-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 177419334) has the molecular formula C26H25NO3S and a molecular weight of 431.56 g/mol. Its IUPAC name is (4S,5R)-5-ethenyl-7-methyl-1-(4-methylphenyl)sulfonyl-4-phenyl-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | (4S,5R)-5-ethenyl-7-methyl-1-(4-methylphenyl)sulfonyl-4-phenyl-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 177419334 |
| Molecular Formula | C26H25NO3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | (4S,5R)-5-ethenyl-7-methyl-1-(4-methylphenyl)sulfonyl-4-phenyl-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | C=C[C@H]1c2cc(C)ccc2N(S(=O)(=O)c2ccc(C)cc2)C(=O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H25NO3S/c1-4-22-23(20-8-6-5-7-9-20)17-26(28)27(25-15-12-19(3)16-24(22)25)31(29,30)21-13-10-18(2)11-14-21/h4-16,22-23H,1,17H2,2-3H3/t22-,23-/m1/s1 |
| InChIKey | RSFWVIYQALXFHC-DHIUTWEWSA-N |
| XLogP | 5.48 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|