C10H9NO4S — CID 82664020
1-(4-methylphenyl)sulfonylazetidine-2,4-dione (PubChem CID 82664020) has the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonylazetidine-2,4-dione.
| Compound Name | 1-(4-methylphenyl)sulfonylazetidine-2,4-dione |
|---|---|
| PubChem CID | 82664020 |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 1-(4-methylphenyl)sulfonylazetidine-2,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)CC2=O)cc1 |
| InChI | InChI=1S/C10H9NO4S/c1-7-2-4-8(5-3-7)16(14,15)11-9(12)6-10(11)13/h2-5H,6H2,1H3 |
| InChIKey | VEYCDEBYHSMMNA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|