C17H17NO3S — CID 71697524
4,6-dimethyl-1-(4-methylphenyl)sulfonyl-3H-indol-2-one (PubChem CID 71697524) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is 4,6-dimethyl-1-(4-methylphenyl)sulfonyl-3H-indol-2-one.
| Compound Name | 4,6-dimethyl-1-(4-methylphenyl)sulfonyl-3H-indol-2-one |
|---|---|
| PubChem CID | 71697524 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4,6-dimethyl-1-(4-methylphenyl)sulfonyl-3H-indol-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)Cc3c(C)cc(C)cc32)cc1 |
| InChI | InChI=1S/C17H17NO3S/c1-11-4-6-14(7-5-11)22(20,21)18-16-9-12(2)8-13(3)15(16)10-17(18)19/h4-9H,10H2,1-3H3 |
| InChIKey | UQXNNJUAFVKYKI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |