C13H15NO3S — CID 132524969
6-methyl-1-(4-methylphenyl)sulfonyl-3,4-dihydropyridin-2-one (PubChem CID 132524969) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is 6-methyl-1-(4-methylphenyl)sulfonyl-3,4-dihydropyridin-2-one.
| Compound Name | 6-methyl-1-(4-methylphenyl)sulfonyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 132524969 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 6-methyl-1-(4-methylphenyl)sulfonyl-3,4-dihydropyridin-2-one |
| SMILES | CC1=CCCC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H15NO3S/c1-10-6-8-12(9-7-10)18(16,17)14-11(2)4-3-5-13(14)15/h4,6-9H,3,5H2,1-2H3 |
| InChIKey | ICMSSQDQECLKQY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |