C18H19NO2S — CID 102483043
2-methyl-1-(4-methylphenyl)sulfonyl-4,5-dihydro-1-benzazepine (PubChem CID 102483043) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-methyl-1-(4-methylphenyl)sulfonyl-4,5-dihydro-1-benzazepine.
| Compound Name | 2-methyl-1-(4-methylphenyl)sulfonyl-4,5-dihydro-1-benzazepine |
|---|---|
| PubChem CID | 102483043 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-methyl-1-(4-methylphenyl)sulfonyl-4,5-dihydro-1-benzazepine |
| SMILES | CC1=CCCc2ccccc2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19NO2S/c1-14-10-12-17(13-11-14)22(20,21)19-15(2)6-5-8-16-7-3-4-9-18(16)19/h3-4,6-7,9-13H,5,8H2,1-2H3 |
| InChIKey | NXGIXYIOUIRHFP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |