C17H14N2O4S — CID 91898973
3-hydroxy-2-(4-methylphenyl)sulfonyl-4H-imidazo[1,5-a]indol-1-one (PubChem CID 91898973) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is 3-hydroxy-2-(4-methylphenyl)sulfonyl-4H-imidazo[1,5-a]indol-1-one.
| Compound Name | 3-hydroxy-2-(4-methylphenyl)sulfonyl-4H-imidazo[1,5-a]indol-1-one |
|---|---|
| PubChem CID | 91898973 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 3-hydroxy-2-(4-methylphenyl)sulfonyl-4H-imidazo[1,5-a]indol-1-one |
| SMILES | Cc1ccc(S(=O)(=O)n2c(O)c3n(c2=O)-c2ccccc2C3)cc1 |
| InChI | InChI=1S/C17H14N2O4S/c1-11-6-8-13(9-7-11)24(22,23)19-16(20)15-10-12-4-2-3-5-14(12)18(15)17(19)21/h2-9,20H,10H2,1H3 |
| InChIKey | YRNVLACLXWBYLK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |