C11H11N3O4S — CID 110191744
6-imino-1-(4-methylphenyl)sulfonyl-1,3-diazinane-2,4-dione (PubChem CID 110191744) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is 6-imino-1-(4-methylphenyl)sulfonyl-1,3-diazinane-2,4-dione.
| Compound Name | 6-imino-1-(4-methylphenyl)sulfonyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 110191744 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 6-imino-1-(4-methylphenyl)sulfonyl-1,3-diazinane-2,4-dione |
| SMILES | [H]/N=C1\CC(=O)NC(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H11N3O4S/c1-7-2-4-8(5-3-7)19(17,18)14-9(12)6-10(15)13-11(14)16/h2-5,12H,6H2,1H3,(H,13,15,16)/b12-9+ |
| InChIKey | HJZJWMQGNGTLBX-FMIVXFBMSA-N |
| XLogP | 0.60 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|