C23H30O6S2 — CID 15155889
3-(4-methylphenyl)sulfonyloxynon-8-enyl 4-methylbenzenesulfonate (PubChem CID 15155889) has the molecular formula C23H30O6S2 and a molecular weight of 466.62 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyloxynon-8-enyl 4-methylbenzenesulfonate.
| Compound Name | 3-(4-methylphenyl)sulfonyloxynon-8-enyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15155889 |
| Molecular Formula | C23H30O6S2 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyloxynon-8-enyl 4-methylbenzenesulfonate |
| SMILES | C=CCCCCC(CCOS(=O)(=O)c1ccc(C)cc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H30O6S2/c1-4-5-6-7-8-21(29-31(26,27)23-15-11-20(3)12-16-23)17-18-28-30(24,25)22-13-9-19(2)10-14-22/h4,9-16,21H,1,5-8,17-18H2,2-3H3 |
| InChIKey | NGCUYPRBEKEROY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|